C15H14F2N2O3 — CID 154342284
(3-methyl-1,2-oxazol-5-yl)methyl 1,1-difluoro-3,4-dihydroisoquinoline-2-carboxylate (PubChem CID 154342284) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 1,1-difluoro-3,4-dihydroisoquinoline-2-carboxylate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 1,1-difluoro-3,4-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 154342284 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 1,1-difluoro-3,4-dihydroisoquinoline-2-carboxylate |
| SMILES | Cc1cc(COC(=O)N2CCc3ccccc3C2(F)F)on1 |
| InChI | InChI=1S/C15H14F2N2O3/c1-10-8-12(22-18-10)9-21-14(20)19-7-6-11-4-2-3-5-13(11)15(19,16)17/h2-5,8H,6-7,9H2,1H3 |
| InChIKey | UIKVGHVSASLLEY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|