C12H13N — CID 154342616
spiro[1H-quinoline-2,1'-cyclobutane] (PubChem CID 154342616) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is spiro[1H-quinoline-2,1'-cyclobutane].
| Compound Name | spiro[1H-quinoline-2,1'-cyclobutane] |
|---|---|
| PubChem CID | 154342616 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | spiro[1H-quinoline-2,1'-cyclobutane] |
| SMILES | C1=CC2(CCC2)Nc2ccccc21 |
| InChI | InChI=1S/C12H13N/c1-2-5-11-10(4-1)6-9-12(13-11)7-3-8-12/h1-2,4-6,9,13H,3,7-8H2 |
| InChIKey | PTDNWLJQBYIRRA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |