C5H4Cl2F3NO2S — CID 154344213
2-(2,3-dichloro-2,3,3-trifluoropropyl)sulfonylacetonitrile (PubChem CID 154344213) has the molecular formula C5H4Cl2F3NO2S and a molecular weight of 270.06 g/mol. Its IUPAC name is 2-(2,3-dichloro-2,3,3-trifluoropropyl)sulfonylacetonitrile.
| Compound Name | 2-(2,3-dichloro-2,3,3-trifluoropropyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 154344213 |
| Molecular Formula | C5H4Cl2F3NO2S |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | 2-(2,3-dichloro-2,3,3-trifluoropropyl)sulfonylacetonitrile |
| SMILES | N#CCS(=O)(=O)CC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5H4Cl2F3NO2S/c6-4(8,5(7,9)10)3-14(12,13)2-1-11/h2-3H2 |
| InChIKey | KXTMMROUJROJQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|