About 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol
1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol (PubChem CID 154344626) has the molecular formula C28H56O3Si
and a molecular weight of 468.84 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol.
Molecular Properties
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol |
| PubChem CID | 154344626 |
| Molecular Formula | C28H56O3Si |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)COCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O3Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(29)26-30-24-25-31-32(5,6)28(2,3)4/h11-12,14-15,27,29H,7-10,13,16-26H2,1-6H3 |
| InChIKey | GGSXASGLKFHMQD-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol?
The IUPAC name of 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol (CID 154344626) is 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol.
What is the SMILES notation for 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol?
The canonical SMILES for 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol is CCCCCC=CCC=CCCCCCCCCC(O)COCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol?
The InChIKey is GGSXASGLKFHMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H56O3Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(29)26-30-24-25-31-32(5,6)28(2,3)4/h11-12,14-15,27,29H,7-10,13,16-26H2,1-6H3.
What are the key properties of 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol?
1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol has a molecular weight of 468.84 g/mol, XLogP of 8.59, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol is sourced from PubChem (CID 154344626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).