C45H80O6 — CID 154344904
2-[2-(2-octadeca-9,12-dienoyloxypropoxy)propoxy]propyl octadeca-9,12-dienoate (PubChem CID 154344904) has the molecular formula C45H80O6 and a molecular weight of 717.13 g/mol. Its IUPAC name is 2-[2-(2-octadeca-9,12-dienoyloxypropoxy)propoxy]propyl octadeca-9,12-dienoate.
| Compound Name | 2-[2-(2-octadeca-9,12-dienoyloxypropoxy)propoxy]propyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 154344904 |
| Molecular Formula | C45H80O6 |
| Molecular Weight | 717.13 g/mol |
| Exact Mass | 716.60 |
| IUPAC Name | 2-[2-(2-octadeca-9,12-dienoyloxypropoxy)propoxy]propyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(C)OCC(C)OCC(C)OC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C45H80O6/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44(46)50-39-42(4)48-38-41(3)49-40-43(5)51-45(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,41-43H,6-13,18-19,24-40H2,1-5H3 |
| InChIKey | JVFOFKSFJGNXCA-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.13 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|