C17H15N2O+ — CID 154346746
1-(6H-indolo[2,3-a]quinolizin-5-ium-3-yl)ethanol (PubChem CID 154346746) has the molecular formula C17H15N2O+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(6H-indolo[2,3-a]quinolizin-5-ium-3-yl)ethanol.
| Compound Name | 1-(6H-indolo[2,3-a]quinolizin-5-ium-3-yl)ethanol |
|---|---|
| PubChem CID | 154346746 |
| Molecular Formula | C17H15N2O+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-(6H-indolo[2,3-a]quinolizin-5-ium-3-yl)ethanol |
| SMILES | CC(O)c1ccc2[n+](c1)CC=C1C2=Nc2ccccc21 |
| InChI | InChI=1S/C17H15N2O/c1-11(20)12-6-7-16-17-14(8-9-19(16)10-12)13-4-2-3-5-15(13)18-17/h2-8,10-11,20H,9H2,1H3/q+1 |
| InChIKey | PZVMFIRQHIUXIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|