About 3-dodecyl-1,1-dimethylurea
3-dodecyl-1,1-dimethylurea (PubChem CID 154348901) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 3-dodecyl-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-dodecyl-1,1-dimethylurea |
| PubChem CID | 154348901 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 3-dodecyl-1,1-dimethylurea |
| SMILES | CCCCCCCCCCCCNC(=O)N(C)C |
| InChI | InChI=1S/C15H32N2O/c1-4-5-6-7-8-9-10-11-12-13-14-16-15(18)17(2)3/h4-14H2,1-3H3,(H,16,18) |
| InChIKey | IJUHNPYSKPPWOG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecyl-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecyl-1,1-dimethylurea?
The IUPAC name of 3-dodecyl-1,1-dimethylurea (CID 154348901) is 3-dodecyl-1,1-dimethylurea.
What is the SMILES notation for 3-dodecyl-1,1-dimethylurea?
The canonical SMILES for 3-dodecyl-1,1-dimethylurea is CCCCCCCCCCCCNC(=O)N(C)C.
What is the InChIKey of 3-dodecyl-1,1-dimethylurea?
The InChIKey is IJUHNPYSKPPWOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-4-5-6-7-8-9-10-11-12-13-14-16-15(18)17(2)3/h4-14H2,1-3H3,(H,16,18).
What are the key properties of 3-dodecyl-1,1-dimethylurea?
3-dodecyl-1,1-dimethylurea has a molecular weight of 256.43 g/mol, XLogP of 4.18, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecyl-1,1-dimethylurea is sourced from PubChem (CID 154348901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).