About 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one
5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one (PubChem CID 15434936) has the molecular formula C9H4Cl3N3O
and a molecular weight of 276.51 g/mol. Its IUPAC name is 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one |
| PubChem CID | 15434936 |
| Molecular Formula | C9H4Cl3N3O |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one |
| SMILES | O=c1nc(Cl)cnn1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H4Cl3N3O/c10-5-1-6(11)3-7(2-5)15-9(16)14-8(12)4-13-15/h1-4H |
| InChIKey | OTFSRVUJIVZNHM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one?
The IUPAC name of 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one (CID 15434936) is 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one.
What is the SMILES notation for 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one?
The canonical SMILES for 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one is O=c1nc(Cl)cnn1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one?
The InChIKey is OTFSRVUJIVZNHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl3N3O/c10-5-1-6(11)3-7(2-5)15-9(16)14-8(12)4-13-15/h1-4H.
What are the key properties of 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one?
5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one has a molecular weight of 276.51 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(3,5-dichlorophenyl)-1,2,4-triazin-3-one is sourced from PubChem (CID 15434936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).