C20H20F3NO — CID 154349379
N,N-dimethyl-3-[3-(trifluoromethyl)benzo[b][1]benzoxepin-6-yl]propan-1-amine (PubChem CID 154349379) has the molecular formula C20H20F3NO and a molecular weight of 347.38 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(trifluoromethyl)benzo[b][1]benzoxepin-6-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[3-(trifluoromethyl)benzo[b][1]benzoxepin-6-yl]propan-1-amine |
|---|---|
| PubChem CID | 154349379 |
| Molecular Formula | C20H20F3NO |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N,N-dimethyl-3-[3-(trifluoromethyl)benzo[b][1]benzoxepin-6-yl]propan-1-amine |
| SMILES | CN(C)CCCC1=Cc2cc(C(F)(F)F)ccc2Oc2ccccc21 |
| InChI | InChI=1S/C20H20F3NO/c1-24(2)11-5-6-14-12-15-13-16(20(21,22)23)9-10-18(15)25-19-8-4-3-7-17(14)19/h3-4,7-10,12-13H,5-6,11H2,1-2H3 |
| InChIKey | CXOMJJHLHOTYMY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|