C16H13F8NO2 — CID 154349425
2,2,2-trifluoro-N-[2,2,4-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]acetamide (PubChem CID 154349425) has the molecular formula C16H13F8NO2 and a molecular weight of 403.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2,2,4-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2,2,4-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 154349425 |
| Molecular Formula | C16H13F8NO2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[2,2,4-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]acetamide |
| SMILES | CC1=C(NC(=O)C(F)(F)F)C(C)(C)Oc2ccc(C(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H13F8NO2/c1-7-9-6-8(14(17,18)16(22,23)24)4-5-10(9)27-13(2,3)11(7)25-12(26)15(19,20)21/h4-6H,1-3H3,(H,25,26) |
| InChIKey | GWPQEXWPYTVGQK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|