About 1,4-diethynyl-6,7-didehydronaphthalene
1,4-diethynyl-6,7-didehydronaphthalene (PubChem CID 154350101) has the molecular formula C14H6
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1,4-diethynyl-6,7-didehydronaphthalene.
Molecular Properties
| Compound Name | 1,4-diethynyl-6,7-didehydronaphthalene |
| PubChem CID | 154350101 |
| Molecular Formula | C14H6 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,4-diethynyl-6,7-didehydronaphthalene |
| SMILES | C#Cc1ccc(C#C)c2cc#ccc12 |
| InChI | InChI=1S/C14H6/c1-3-11-9-10-12(4-2)14-8-6-5-7-13(11)14/h1-2,7-10H |
| InChIKey | CZALSNYIFRXIIZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethynyl-6,7-didehydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethynyl-6,7-didehydronaphthalene?
The IUPAC name of 1,4-diethynyl-6,7-didehydronaphthalene (CID 154350101) is 1,4-diethynyl-6,7-didehydronaphthalene.
What is the SMILES notation for 1,4-diethynyl-6,7-didehydronaphthalene?
The canonical SMILES for 1,4-diethynyl-6,7-didehydronaphthalene is C#Cc1ccc(C#C)c2cc#ccc12.
What is the InChIKey of 1,4-diethynyl-6,7-didehydronaphthalene?
The InChIKey is CZALSNYIFRXIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6/c1-3-11-9-10-12(4-2)14-8-6-5-7-13(11)14/h1-2,7-10H.
What are the key properties of 1,4-diethynyl-6,7-didehydronaphthalene?
1,4-diethynyl-6,7-didehydronaphthalene has a molecular weight of 174.20 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethynyl-6,7-didehydronaphthalene is sourced from PubChem (CID 154350101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).