C19H16BrNOS — CID 15435111
(4-bromophenyl)-(2-pyrrolidin-1-yl-1-benzothiophen-3-yl)methanone (PubChem CID 15435111) has the molecular formula C19H16BrNOS and a molecular weight of 386.31 g/mol. Its IUPAC name is (4-bromophenyl)-(2-pyrrolidin-1-yl-1-benzothiophen-3-yl)methanone.
| Compound Name | (4-bromophenyl)-(2-pyrrolidin-1-yl-1-benzothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 15435111 |
| Molecular Formula | C19H16BrNOS |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | (4-bromophenyl)-(2-pyrrolidin-1-yl-1-benzothiophen-3-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1c(N2CCCC2)sc2ccccc12 |
| InChI | InChI=1S/C19H16BrNOS/c20-14-9-7-13(8-10-14)18(22)17-15-5-1-2-6-16(15)23-19(17)21-11-3-4-12-21/h1-2,5-10H,3-4,11-12H2 |
| InChIKey | XNXCJPVOVHTYKK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |