C21H24N2O5 — CID 15435208
N-hydroxy-2-(4-methoxy-3-phenylmethoxy-5-propylphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 15435208) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-hydroxy-2-(4-methoxy-3-phenylmethoxy-5-propylphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | N-hydroxy-2-(4-methoxy-3-phenylmethoxy-5-propylphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 15435208 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-hydroxy-2-(4-methoxy-3-phenylmethoxy-5-propylphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | CCCc1cc(C2=NC(C(=O)NO)CO2)cc(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C21H24N2O5/c1-3-7-15-10-16(21-22-17(13-28-21)20(24)23-25)11-18(19(15)26-2)27-12-14-8-5-4-6-9-14/h4-6,8-11,17,25H,3,7,12-13H2,1-2H3,(H,23,24) |
| InChIKey | KOZGEXOUZIPKIU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|