About 1-chloro-N,N-diethylsilolan-1-amine
1-chloro-N,N-diethylsilolan-1-amine (PubChem CID 154352080) has the molecular formula C8H18ClNSi
and a molecular weight of 191.78 g/mol. Its IUPAC name is 1-chloro-N,N-diethylsilolan-1-amine.
Molecular Properties
| Compound Name | 1-chloro-N,N-diethylsilolan-1-amine |
| PubChem CID | 154352080 |
| Molecular Formula | C8H18ClNSi |
| Molecular Weight | 191.78 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-chloro-N,N-diethylsilolan-1-amine |
| SMILES | CCN(CC)[Si]1(Cl)CCCC1 |
| InChI | InChI=1S/C8H18ClNSi/c1-3-10(4-2)11(9)7-5-6-8-11/h3-8H2,1-2H3 |
| InChIKey | FBOBJMHVVLZJJC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-diethylsilolan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-diethylsilolan-1-amine?
The IUPAC name of 1-chloro-N,N-diethylsilolan-1-amine (CID 154352080) is 1-chloro-N,N-diethylsilolan-1-amine.
What is the SMILES notation for 1-chloro-N,N-diethylsilolan-1-amine?
The canonical SMILES for 1-chloro-N,N-diethylsilolan-1-amine is CCN(CC)[Si]1(Cl)CCCC1.
What is the InChIKey of 1-chloro-N,N-diethylsilolan-1-amine?
The InChIKey is FBOBJMHVVLZJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNSi/c1-3-10(4-2)11(9)7-5-6-8-11/h3-8H2,1-2H3.
What are the key properties of 1-chloro-N,N-diethylsilolan-1-amine?
1-chloro-N,N-diethylsilolan-1-amine has a molecular weight of 191.78 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-diethylsilolan-1-amine is sourced from PubChem (CID 154352080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).