About 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione
1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione (PubChem CID 15435240) has the molecular formula C19H16N4O4S
and a molecular weight of 396.43 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione |
| PubChem CID | 15435240 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione |
| SMILES | COc1cc2nc(-c3cccs3)nc(NN3C(=O)C=C(C)C3=O)c2cc1OC |
| InChI | InChI=1S/C19H16N4O4S/c1-10-7-16(24)23(19(10)25)22-17-11-8-13(26-2)14(27-3)9-12(11)20-18(21-17)15-5-4-6-28-15/h4-9H,1-3H3,(H,20,21,22) |
| InChIKey | XAOSTTDZPGBTEB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione?
The IUPAC name of 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione (CID 15435240) is 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione.
What is the SMILES notation for 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione?
The canonical SMILES for 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione is COc1cc2nc(-c3cccs3)nc(NN3C(=O)C=C(C)C3=O)c2cc1OC.
What is the InChIKey of 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione?
The InChIKey is XAOSTTDZPGBTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O4S/c1-10-7-16(24)23(19(10)25)22-17-11-8-13(26-2)14(27-3)9-12(11)20-18(21-17)15-5-4-6-28-15/h4-9H,1-3H3,(H,20,21,22).
What are the key properties of 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione?
1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione has a molecular weight of 396.43 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6,7-dimethoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-3-methylpyrrole-2,5-dione is sourced from PubChem (CID 15435240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).