About 1-phenyl-3,5-dihydropyrazol-3-id-4-one
1-phenyl-3,5-dihydropyrazol-3-id-4-one (PubChem CID 154353391) has the molecular formula C9H7N2O-
and a molecular weight of 159.17 g/mol. Its IUPAC name is 1-phenyl-3,5-dihydropyrazol-3-id-4-one.
Molecular Properties
| Compound Name | 1-phenyl-3,5-dihydropyrazol-3-id-4-one |
| PubChem CID | 154353391 |
| Molecular Formula | C9H7N2O- |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 1-phenyl-3,5-dihydropyrazol-3-id-4-one |
| SMILES | O=C1[C-]=NN(c2ccccc2)C1 |
| InChI | InChI=1S/C9H7N2O/c12-9-6-10-11(7-9)8-4-2-1-3-5-8/h1-5H,7H2/q-1 |
| InChIKey | TUIBSLDKJYAHIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-3,5-dihydropyrazol-3-id-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3,5-dihydropyrazol-3-id-4-one?
The IUPAC name of 1-phenyl-3,5-dihydropyrazol-3-id-4-one (CID 154353391) is 1-phenyl-3,5-dihydropyrazol-3-id-4-one.
What is the SMILES notation for 1-phenyl-3,5-dihydropyrazol-3-id-4-one?
The canonical SMILES for 1-phenyl-3,5-dihydropyrazol-3-id-4-one is O=C1[C-]=NN(c2ccccc2)C1.
What is the InChIKey of 1-phenyl-3,5-dihydropyrazol-3-id-4-one?
The InChIKey is TUIBSLDKJYAHIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2O/c12-9-6-10-11(7-9)8-4-2-1-3-5-8/h1-5H,7H2/q-1.
What are the key properties of 1-phenyl-3,5-dihydropyrazol-3-id-4-one?
1-phenyl-3,5-dihydropyrazol-3-id-4-one has a molecular weight of 159.17 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3,5-dihydropyrazol-3-id-4-one is sourced from PubChem (CID 154353391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).