C17H13ClF5N5 — CID 15435422
5-chloro-N-ethyl-N-(2-methylprop-2-enyl)-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 15435422) has the molecular formula C17H13ClF5N5 and a molecular weight of 417.77 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-(2-methylprop-2-enyl)-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-ethyl-N-(2-methylprop-2-enyl)-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 15435422 |
| Molecular Formula | C17H13ClF5N5 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 5-chloro-N-ethyl-N-(2-methylprop-2-enyl)-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C(C)CN(CC)c1c(-c2c(F)c(F)c(F)c(F)c2F)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C17H13ClF5N5/c1-4-27(5-7(2)3)16-9(15(18)26-17-24-6-25-28(16)17)8-10(19)12(21)14(23)13(22)11(8)20/h6H,2,4-5H2,1,3H3 |
| InChIKey | JJSGOVIYAMOZFS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|