C22H32N2O4S2 — CID 154354347
[(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis(thiophen-3-ylmethyl)carbamate (PubChem CID 154354347) has the molecular formula C22H32N2O4S2 and a molecular weight of 452.64 g/mol. Its IUPAC name is [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis(thiophen-3-ylmethyl)carbamate.
| Compound Name | [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis(thiophen-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 154354347 |
| Molecular Formula | C22H32N2O4S2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis(thiophen-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)CCCC[C@@H](COC(=O)N(Cc1ccsc1)Cc1ccsc1)OC(N)=O |
| InChI | InChI=1S/C22H32N2O4S2/c1-22(2,3)9-5-4-6-19(28-20(23)25)14-27-21(26)24(12-17-7-10-29-15-17)13-18-8-11-30-16-18/h7-8,10-11,15-16,19H,4-6,9,12-14H2,1-3H3,(H2,23,25)/t19-/m0/s1 |
| InChIKey | AOOTWIOLQVLGNN-IBGZPJMESA-N |
| XLogP | 6.02 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|