About 4-phenyltrioxan-4-ol
4-phenyltrioxan-4-ol (PubChem CID 154355224) has the molecular formula C9H10O4
and a molecular weight of 182.18 g/mol. Its IUPAC name is 4-phenyltrioxan-4-ol.
Molecular Properties
| Compound Name | 4-phenyltrioxan-4-ol |
| PubChem CID | 154355224 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4-phenyltrioxan-4-ol |
| SMILES | OC1(c2ccccc2)CCOOO1 |
| InChI | InChI=1S/C9H10O4/c10-9(6-7-11-13-12-9)8-4-2-1-3-5-8/h1-5,10H,6-7H2 |
| InChIKey | BWNJQWSOZFRRCD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyltrioxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyltrioxan-4-ol?
The IUPAC name of 4-phenyltrioxan-4-ol (CID 154355224) is 4-phenyltrioxan-4-ol.
What is the SMILES notation for 4-phenyltrioxan-4-ol?
The canonical SMILES for 4-phenyltrioxan-4-ol is OC1(c2ccccc2)CCOOO1.
What is the InChIKey of 4-phenyltrioxan-4-ol?
The InChIKey is BWNJQWSOZFRRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c10-9(6-7-11-13-12-9)8-4-2-1-3-5-8/h1-5,10H,6-7H2.
What are the key properties of 4-phenyltrioxan-4-ol?
4-phenyltrioxan-4-ol has a molecular weight of 182.18 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyltrioxan-4-ol is sourced from PubChem (CID 154355224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).