About 2,1,5-benzothiadiazepine
2,1,5-benzothiadiazepine (PubChem CID 154357630) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is 2,1,5-benzothiadiazepine.
Molecular Properties
| Compound Name | 2,1,5-benzothiadiazepine |
| PubChem CID | 154357630 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 2,1,5-benzothiadiazepine |
| SMILES | C1=CSN=c2ccccc2=N1 |
| InChI | InChI=1S/C8H6N2S/c1-2-4-8-7(3-1)9-5-6-11-10-8/h1-6H |
| InChIKey | MBEQIZOTGZAJLV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,1,5-benzothiadiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1,5-benzothiadiazepine?
The IUPAC name of 2,1,5-benzothiadiazepine (CID 154357630) is 2,1,5-benzothiadiazepine.
What is the SMILES notation for 2,1,5-benzothiadiazepine?
The canonical SMILES for 2,1,5-benzothiadiazepine is C1=CSN=c2ccccc2=N1.
What is the InChIKey of 2,1,5-benzothiadiazepine?
The InChIKey is MBEQIZOTGZAJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c1-2-4-8-7(3-1)9-5-6-11-10-8/h1-6H.
What are the key properties of 2,1,5-benzothiadiazepine?
2,1,5-benzothiadiazepine has a molecular weight of 162.22 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,5-benzothiadiazepine is sourced from PubChem (CID 154357630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).