C17H21N5O2S — CID 154360660
N'-(cyclohexylmethyl)-4-methyl-N-(2-nitrophenyl)thiadiazole-5-carboximidamide (PubChem CID 154360660) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-4-methyl-N-(2-nitrophenyl)thiadiazole-5-carboximidamide.
| Compound Name | N'-(cyclohexylmethyl)-4-methyl-N-(2-nitrophenyl)thiadiazole-5-carboximidamide |
|---|---|
| PubChem CID | 154360660 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N'-(cyclohexylmethyl)-4-methyl-N-(2-nitrophenyl)thiadiazole-5-carboximidamide |
| SMILES | Cc1nnsc1/C(=N\CC1CCCCC1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O2S/c1-12-16(25-21-20-12)17(18-11-13-7-3-2-4-8-13)19-14-9-5-6-10-15(14)22(23)24/h5-6,9-10,13H,2-4,7-8,11H2,1H3,(H,18,19) |
| InChIKey | WKZMOUBBPKBCEI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|