About 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one
1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one (PubChem CID 154361076) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one.
Molecular Properties
| Compound Name | 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one |
| PubChem CID | 154361076 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1(OC)C(C)=CCC=C1C |
| InChI | InChI=1S/C14H22O2/c1-5-6-10-13(15)14(16-4)11(2)8-7-9-12(14)3/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | OTWVNEHSQQHZML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one?
The IUPAC name of 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one (CID 154361076) is 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one.
What is the SMILES notation for 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one?
The canonical SMILES for 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one is CCCCC(=O)C1(OC)C(C)=CCC=C1C.
What is the InChIKey of 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one?
The InChIKey is OTWVNEHSQQHZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-5-6-10-13(15)14(16-4)11(2)8-7-9-12(14)3/h8-9H,5-7,10H2,1-4H3.
What are the key properties of 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one?
1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one has a molecular weight of 222.33 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxy-2,6-dimethylcyclohexa-2,5-dien-1-yl)pentan-1-one is sourced from PubChem (CID 154361076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).