C22H29N3O — CID 154361288
2-methyl-2-(3-methylanilino)-3-(1-pyridin-2-ylcyclohexyl)propanamide (PubChem CID 154361288) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-methyl-2-(3-methylanilino)-3-(1-pyridin-2-ylcyclohexyl)propanamide.
| Compound Name | 2-methyl-2-(3-methylanilino)-3-(1-pyridin-2-ylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 154361288 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-methyl-2-(3-methylanilino)-3-(1-pyridin-2-ylcyclohexyl)propanamide |
| SMILES | Cc1cccc(NC(C)(CC2(c3ccccn3)CCCCC2)C(N)=O)c1 |
| InChI | InChI=1S/C22H29N3O/c1-17-9-8-10-18(15-17)25-21(2,20(23)26)16-22(12-5-3-6-13-22)19-11-4-7-14-24-19/h4,7-11,14-15,25H,3,5-6,12-13,16H2,1-2H3,(H2,23,26) |
| InChIKey | HJUCSCAZTGISQZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |