About 2-piperidin-1-ylindazole
2-piperidin-1-ylindazole (PubChem CID 154361634) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-piperidin-1-ylindazole.
Molecular Properties
| Compound Name | 2-piperidin-1-ylindazole |
| PubChem CID | 154361634 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-piperidin-1-ylindazole |
| SMILES | c1ccc2nn(N3CCCCC3)cc2c1 |
| InChI | InChI=1S/C12H15N3/c1-4-8-14(9-5-1)15-10-11-6-2-3-7-12(11)13-15/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | PSZDSNKICBDDDC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylindazole?
The IUPAC name of 2-piperidin-1-ylindazole (CID 154361634) is 2-piperidin-1-ylindazole.
What is the SMILES notation for 2-piperidin-1-ylindazole?
The canonical SMILES for 2-piperidin-1-ylindazole is c1ccc2nn(N3CCCCC3)cc2c1.
What is the InChIKey of 2-piperidin-1-ylindazole?
The InChIKey is PSZDSNKICBDDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-4-8-14(9-5-1)15-10-11-6-2-3-7-12(11)13-15/h2-3,6-7,10H,1,4-5,8-9H2.
What are the key properties of 2-piperidin-1-ylindazole?
2-piperidin-1-ylindazole has a molecular weight of 201.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylindazole is sourced from PubChem (CID 154361634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).