C33H43F6N4O3- — CID 154362277
1-[(2S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]-2-[(4R)-4-methyl-4-(4-propan-2-yloxyphenyl)imidazolidin-3-id-1-yl]ethanone (PubChem CID 154362277) has the molecular formula C33H43F6N4O3- and a molecular weight of 657.72 g/mol. Its IUPAC name is 1-[(2S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]-2-[(4R)-4-methyl-4-(4-propan-2-yloxyphenyl)imidazolidin-3-id-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]-2-[(4R)-4-methyl-4-(4-propan-2-yloxyphenyl)imidazolidin-3-id-1-yl]ethanone |
|---|---|
| PubChem CID | 154362277 |
| Molecular Formula | C33H43F6N4O3- |
| Molecular Weight | 657.72 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | 1-[(2S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]-2,5-dimethylpiperazin-1-yl]-2-[(4R)-4-methyl-4-(4-propan-2-yloxyphenyl)imidazolidin-3-id-1-yl]ethanone |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N1C[C@H](C)N(C(=O)CN2C[N-][C@](C)(c3ccc(OC(C)C)cc3)C2)CC1C |
| InChI | InChI=1S/C33H43F6N4O3/c1-7-8-24-15-26(31(45,32(34,35)36)33(37,38)39)11-14-28(24)42-16-23(5)43(17-22(42)4)29(44)18-41-19-30(6,40-20-41)25-9-12-27(13-10-25)46-21(2)3/h9-15,21-23,45H,7-8,16-20H2,1-6H3/q-1/t22?,23-,30-/m0/s1 |
| InChIKey | UQRULZQRFJAKTL-NQOFDSNCSA-N |
| XLogP | 6.73 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|