C3H8N2OP+ — CID 154362537
1-methyl-1,3,2-diazaphospholidin-2-ium 2-oxide (PubChem CID 154362537) has the molecular formula C3H8N2OP+ and a molecular weight of 119.08 g/mol. Its IUPAC name is 1-methyl-1,3,2-diazaphospholidin-2-ium 2-oxide.
| Compound Name | 1-methyl-1,3,2-diazaphospholidin-2-ium 2-oxide |
|---|---|
| PubChem CID | 154362537 |
| Molecular Formula | C3H8N2OP+ |
| Molecular Weight | 119.08 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 1-methyl-1,3,2-diazaphospholidin-2-ium 2-oxide |
| SMILES | CN1CCN[P+]1=O |
| InChI | InChI=1S/C3H8N2OP/c1-5-3-2-4-7(5)6/h2-3H2,1H3,(H,4,6)/q+1 |
| InChIKey | FGUGHVFQVUMKGR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.08 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|