C21H19F5N2O3 — CID 154363273
N-methyl-N-[2,2,5-trimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]formamide (PubChem CID 154363273) has the molecular formula C21H19F5N2O3 and a molecular weight of 442.38 g/mol. Its IUPAC name is N-methyl-N-[2,2,5-trimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]formamide.
| Compound Name | N-methyl-N-[2,2,5-trimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]formamide |
|---|---|
| PubChem CID | 154363273 |
| Molecular Formula | C21H19F5N2O3 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-methyl-N-[2,2,5-trimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]formamide |
| SMILES | Cc1c(C(F)(F)C(F)(F)F)ccc2c1C(n1ccccc1=O)=C(N(C)C=O)C(C)(C)O2 |
| InChI | InChI=1S/C21H19F5N2O3/c1-12-13(20(22,23)21(24,25)26)8-9-14-16(12)17(28-10-6-5-7-15(28)30)18(27(4)11-29)19(2,3)31-14/h5-11H,1-4H3 |
| InChIKey | ISUMGROECBSRIA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|