C18H34N4 — CID 154365130
1-N'-(cyclobutylamino)-1-N'-(cyclopentylamino)-1-N-cyclopropylcyclohexane-1,1-diamine (PubChem CID 154365130) has the molecular formula C18H34N4 and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-N'-(cyclobutylamino)-1-N'-(cyclopentylamino)-1-N-cyclopropylcyclohexane-1,1-diamine.
| Compound Name | 1-N'-(cyclobutylamino)-1-N'-(cyclopentylamino)-1-N-cyclopropylcyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 154365130 |
| Molecular Formula | C18H34N4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 1-N'-(cyclobutylamino)-1-N'-(cyclopentylamino)-1-N-cyclopropylcyclohexane-1,1-diamine |
| SMILES | C1CCC(NC2CC2)(N(NC2CCCC2)NC2CCC2)CC1 |
| InChI | InChI=1S/C18H34N4/c1-4-13-18(14-5-1,19-15-11-12-15)22(21-17-9-6-10-17)20-16-7-2-3-8-16/h15-17,19-21H,1-14H2 |
| InChIKey | BWEVZFWNIPREOB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|