C18H27P — CID 154370518
tri(cyclohex-2-en-1-yl)phosphane (PubChem CID 154370518) has the molecular formula C18H27P and a molecular weight of 274.39 g/mol. Its IUPAC name is tri(cyclohex-2-en-1-yl)phosphane.
| Compound Name | tri(cyclohex-2-en-1-yl)phosphane |
|---|---|
| PubChem CID | 154370518 |
| Molecular Formula | C18H27P |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | tri(cyclohex-2-en-1-yl)phosphane |
| SMILES | C1=CC(P(C2C=CCCC2)C2C=CCCC2)CCC1 |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4,6,8,10,12,14,16-18H,1-3,5,7,9,11,13,15H2 |
| InChIKey | WMHRPFBICKLVHT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|