C7H5N5O — CID 154371562
1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraen-12-one (PubChem CID 154371562) has the molecular formula C7H5N5O and a molecular weight of 175.15 g/mol. Its IUPAC name is 1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraen-12-one.
| Compound Name | 1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraen-12-one |
|---|---|
| PubChem CID | 154371562 |
| Molecular Formula | C7H5N5O |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraen-12-one |
| SMILES | O=c1[nH]nc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C7H5N5O/c13-7-11-10-5-3-9-6-4(12(5)7)1-2-8-6/h1-3,8H,(H,11,13) |
| InChIKey | NBQUXJMQMYQFHF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |