C13H10Cl2N4 — CID 154372537
2-[1-[(3,5-dichlorophenyl)methyl]imidazolidin-2-ylidene]propanedinitrile (PubChem CID 154372537) has the molecular formula C13H10Cl2N4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 2-[1-[(3,5-dichlorophenyl)methyl]imidazolidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-[(3,5-dichlorophenyl)methyl]imidazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 154372537 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-[1-[(3,5-dichlorophenyl)methyl]imidazolidin-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1NCCN1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N4/c14-11-3-9(4-12(15)5-11)8-19-2-1-18-13(19)10(6-16)7-17/h3-5,18H,1-2,8H2 |
| InChIKey | TZNRHTRSGCUINY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|