C29H51ClO — CID 154374864
(3S,6S,8S,9S,10R,13R,14S,17R)-6-chloro-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 154374864) has the molecular formula C29H51ClO and a molecular weight of 451.18 g/mol. Its IUPAC name is (3S,6S,8S,9S,10R,13R,14S,17R)-6-chloro-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,6S,8S,9S,10R,13R,14S,17R)-6-chloro-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154374864 |
| Molecular Formula | C29H51ClO |
| Molecular Weight | 451.18 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | (3S,6S,8S,9S,10R,13R,14S,17R)-6-chloro-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@H](Cl)C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C29H51ClO/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(30)26-16-21(31)12-14-29(26,6)25(22)13-15-28(23,24)5/h18-27,31H,7-17H2,1-6H3/t19-,20?,21+,22+,23-,24+,25+,26?,27+,28-,29-/m1/s1 |
| InChIKey | LIAAUYBWQNDNGH-QTFHYPGISA-N |
| XLogP | 8.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.18 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|