C15H18O5S — CID 15437508
methyl 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanoate (PubChem CID 15437508) has the molecular formula C15H18O5S and a molecular weight of 310.37 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanoate.
| Compound Name | methyl 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanoate |
|---|---|
| PubChem CID | 15437508 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanoate |
| SMILES | C=C=COCCCC(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O5S/c1-3-11-20-12-7-10-14(15(16)19-2)21(17,18)13-8-5-4-6-9-13/h4-6,8-9,11,14H,1,7,10,12H2,2H3 |
| InChIKey | VIZBQZVMPXIKCX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|