About 5-fluoro-3-methoxy-1H-1,2,4-triazole
5-fluoro-3-methoxy-1H-1,2,4-triazole (PubChem CID 154377172) has the molecular formula C3H4FN3O
and a molecular weight of 117.08 g/mol. Its IUPAC name is 5-fluoro-3-methoxy-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-fluoro-3-methoxy-1H-1,2,4-triazole |
| PubChem CID | 154377172 |
| Molecular Formula | C3H4FN3O |
| Molecular Weight | 117.08 g/mol |
| Exact Mass | 117.03 |
| IUPAC Name | 5-fluoro-3-methoxy-1H-1,2,4-triazole |
| SMILES | COc1n[nH]c(F)n1 |
| InChI | InChI=1S/C3H4FN3O/c1-8-3-5-2(4)6-7-3/h1H3,(H,5,6,7) |
| InChIKey | CJIDCQMXLMJLRJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.08 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-3-methoxy-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methoxy-1H-1,2,4-triazole?
The IUPAC name of 5-fluoro-3-methoxy-1H-1,2,4-triazole (CID 154377172) is 5-fluoro-3-methoxy-1H-1,2,4-triazole.
What is the SMILES notation for 5-fluoro-3-methoxy-1H-1,2,4-triazole?
The canonical SMILES for 5-fluoro-3-methoxy-1H-1,2,4-triazole is COc1n[nH]c(F)n1.
What is the InChIKey of 5-fluoro-3-methoxy-1H-1,2,4-triazole?
The InChIKey is CJIDCQMXLMJLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4FN3O/c1-8-3-5-2(4)6-7-3/h1H3,(H,5,6,7).
What are the key properties of 5-fluoro-3-methoxy-1H-1,2,4-triazole?
5-fluoro-3-methoxy-1H-1,2,4-triazole has a molecular weight of 117.08 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methoxy-1H-1,2,4-triazole is sourced from PubChem (CID 154377172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).