C11H21N3O2 — CID 154378074
(8R,8aR)-2-tert-butyl-8-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 154378074) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is (8R,8aR)-2-tert-butyl-8-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8R,8aR)-2-tert-butyl-8-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 154378074 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (8R,8aR)-2-tert-butyl-8-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC(C)(C)N1C[C@@H]2[C@H](CO)NCCN2C1=O |
| InChI | InChI=1S/C11H21N3O2/c1-11(2,3)14-6-9-8(7-15)12-4-5-13(9)10(14)16/h8-9,12,15H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | VMVXAZWPDZATAQ-DTWKUNHWSA-N |
| XLogP | -0.14 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |