About (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane
(2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane (PubChem CID 15437935) has the molecular formula C11H13N3S2
and a molecular weight of 251.38 g/mol. Its IUPAC name is (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane.
Molecular Properties
| Compound Name | (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane |
| PubChem CID | 15437935 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane |
| SMILES | C[C@]1(N=[N+]=[N-])SCCS[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H13N3S2/c1-11(13-14-12)10(15-7-8-16-11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | DULCSKLNKMHVJQ-MNOVXSKESA-N |
| XLogP | 4.23 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane?
The IUPAC name of (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane (CID 15437935) is (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane.
What is the SMILES notation for (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane?
The canonical SMILES for (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane is C[C@]1(N=[N+]=[N-])SCCS[C@@H]1c1ccccc1.
What is the InChIKey of (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane?
The InChIKey is DULCSKLNKMHVJQ-MNOVXSKESA-N. The full InChI is InChI=1S/C11H13N3S2/c1-11(13-14-12)10(15-7-8-16-11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,11+/m1/s1.
What are the key properties of (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane?
(2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane has a molecular weight of 251.38 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-azido-2-methyl-3-phenyl-1,4-dithiane is sourced from PubChem (CID 15437935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).