C8H8Cl4 — CID 154379843
3,3,6,6-tetrachloro-1,4-dimethylcyclohexa-1,4-diene (PubChem CID 154379843) has the molecular formula C8H8Cl4 and a molecular weight of 245.96 g/mol. Its IUPAC name is 3,3,6,6-tetrachloro-1,4-dimethylcyclohexa-1,4-diene.
| Compound Name | 3,3,6,6-tetrachloro-1,4-dimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 154379843 |
| Molecular Formula | C8H8Cl4 |
| Molecular Weight | 245.96 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 3,3,6,6-tetrachloro-1,4-dimethylcyclohexa-1,4-diene |
| SMILES | CC1=CC(Cl)(Cl)C(C)=CC1(Cl)Cl |
| InChI | InChI=1S/C8H8Cl4/c1-5-3-8(11,12)6(2)4-7(5,9)10/h3-4H,1-2H3 |
| InChIKey | PPXFTSDUKKCLGH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|