C24H32N2O — CID 154380891
3-[(7R,8R,9aR)-7,8-dimethyl-1-(2-phenylethyl)-1,2,3,4,6,7,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol (PubChem CID 154380891) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-[(7R,8R,9aR)-7,8-dimethyl-1-(2-phenylethyl)-1,2,3,4,6,7,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol.
| Compound Name | 3-[(7R,8R,9aR)-7,8-dimethyl-1-(2-phenylethyl)-1,2,3,4,6,7,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol |
|---|---|
| PubChem CID | 154380891 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-[(7R,8R,9aR)-7,8-dimethyl-1-(2-phenylethyl)-1,2,3,4,6,7,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol |
| SMILES | C[C@H]1CN2CCNC(CCc3ccccc3)[C@H]2C[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C24H32N2O/c1-18-17-26-14-13-25-22(12-11-19-7-4-3-5-8-19)23(26)16-24(18,2)20-9-6-10-21(27)15-20/h3-10,15,18,22-23,25,27H,11-14,16-17H2,1-2H3/t18-,22?,23+,24+/m0/s1 |
| InChIKey | FUDOMMCUANXTBQ-BELCSOQASA-N |
| XLogP | 3.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |