About 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate
2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate (PubChem CID 15438258) has the molecular formula C14H20ClNO4
and a molecular weight of 301.77 g/mol. Its IUPAC name is 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate.
Molecular Properties
| Compound Name | 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate |
| PubChem CID | 15438258 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate |
| SMILES | C[C@@H](N[C@@H](CO)COC(=O)OCCCl)c1ccccc1 |
| InChI | InChI=1S/C14H20ClNO4/c1-11(12-5-3-2-4-6-12)16-13(9-17)10-20-14(18)19-8-7-15/h2-6,11,13,16-17H,7-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | KCCHIFMJPYZEDA-YPMHNXCESA-N |
| XLogP | 2.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate?
The IUPAC name of 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate (CID 15438258) is 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate.
What is the SMILES notation for 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate?
The canonical SMILES for 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate is C[C@@H](N[C@@H](CO)COC(=O)OCCCl)c1ccccc1.
What is the InChIKey of 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate?
The InChIKey is KCCHIFMJPYZEDA-YPMHNXCESA-N. The full InChI is InChI=1S/C14H20ClNO4/c1-11(12-5-3-2-4-6-12)16-13(9-17)10-20-14(18)19-8-7-15/h2-6,11,13,16-17H,7-10H2,1H3/t11-,13+/m1/s1.
What are the key properties of 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate?
2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate has a molecular weight of 301.77 g/mol, XLogP of 2.09, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl [(2S)-3-hydroxy-2-[[(1R)-1-phenylethyl]amino]propyl] carbonate is sourced from PubChem (CID 15438258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).