C14H20N2O6 — CID 154383024
3,3-dimethyl-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone (PubChem CID 154383024) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone.
| Compound Name | 3,3-dimethyl-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 154383024 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3,3-dimethyl-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
| SMILES | CC1(C)OC(=O)CCNC(=O)CNC(=O)C=CCCOC1=O |
| InChI | InChI=1S/C14H20N2O6/c1-14(2)13(20)21-8-4-3-5-10(17)16-9-11(18)15-7-6-12(19)22-14/h3,5H,4,6-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | MPLIQXHUFJHMDI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |