C9H9ClN4S2 — CID 15438363
8-chloro-5-methylsulfanyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 15438363) has the molecular formula C9H9ClN4S2 and a molecular weight of 272.79 g/mol. Its IUPAC name is 8-chloro-5-methylsulfanyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 8-chloro-5-methylsulfanyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 15438363 |
| Molecular Formula | C9H9ClN4S2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 8-chloro-5-methylsulfanyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | CSc1nc2nc3c(c(Cl)n2n1)SCCC3 |
| InChI | InChI=1S/C9H9ClN4S2/c1-15-9-12-8-11-5-3-2-4-16-6(5)7(10)14(8)13-9/h2-4H2,1H3 |
| InChIKey | FSTBQJGFFGNCIN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |