C21H24FN3O3S — CID 154384810
5-amino-1-cyclopropyl-6-fluoro-7-[5-(hydroxymethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methyl-6,7-dihydroquinazoline-2,4-dione (PubChem CID 154384810) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6-fluoro-7-[5-(hydroxymethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methyl-6,7-dihydroquinazoline-2,4-dione.
| Compound Name | 5-amino-1-cyclopropyl-6-fluoro-7-[5-(hydroxymethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methyl-6,7-dihydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 154384810 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 5-amino-1-cyclopropyl-6-fluoro-7-[5-(hydroxymethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methyl-6,7-dihydroquinazoline-2,4-dione |
| SMILES | CC1=c2c(c(=O)[nH]c(=O)n2C2CC2)=C(N)C(F)C1c1cc2c(s1)CCC(CO)C2 |
| InChI | InChI=1S/C21H24FN3O3S/c1-9-15(14-7-11-6-10(8-26)2-5-13(11)29-14)17(22)18(23)16-19(9)25(12-3-4-12)21(28)24-20(16)27/h7,10,12,15,17,26H,2-6,8,23H2,1H3,(H,24,27,28) |
| InChIKey | PSRKABRHILOASF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |