C15H14N2S — CID 154386319
1-benzyl-4-methylsulfanylpyrrolo[3,2-c]pyridine (PubChem CID 154386319) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-benzyl-4-methylsulfanylpyrrolo[3,2-c]pyridine.
| Compound Name | 1-benzyl-4-methylsulfanylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 154386319 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-benzyl-4-methylsulfanylpyrrolo[3,2-c]pyridine |
| SMILES | CSc1nccc2c1ccn2Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2S/c1-18-15-13-8-10-17(14(13)7-9-16-15)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | YMZVYRGIIIONAK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |