C15H24O6 — CID 15438724
cis-diethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate (PubChem CID 15438724) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is cis-diethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15438724 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | cis-diethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@](C)(O)[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C15H24O6/c1-5-20-12(17)15(13(18)21-6-2)8-7-14(4,19)11(9-15)10(3)16/h11,19H,5-9H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | JJHTYGMKQXUEPN-FZMZJTMJSA-N |
| XLogP | 1.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|