About cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate
cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate (PubChem CID 15438726) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate |
| PubChem CID | 15438726 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C#N)CC[C@](C)(O)[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C13H19NO4/c1-4-18-11(16)13(8-14)6-5-12(3,17)10(7-13)9(2)15/h10,17H,4-7H2,1-3H3/t10-,12-,13?/m0/s1 |
| InChIKey | AMOGPMRWYQJEHF-QDYONFDCSA-N |
| XLogP | 1.20 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate?
The IUPAC name of cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate (CID 15438726) is cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate?
The canonical SMILES for cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate is CCOC(=O)C1(C#N)CC[C@](C)(O)[C@H](C(C)=O)C1.
What is the InChIKey of cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate?
The InChIKey is AMOGPMRWYQJEHF-QDYONFDCSA-N. The full InChI is InChI=1S/C13H19NO4/c1-4-18-11(16)13(8-14)6-5-12(3,17)10(7-13)9(2)15/h10,17H,4-7H2,1-3H3/t10-,12-,13?/m0/s1.
What are the key properties of cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate?
cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate has a molecular weight of 253.30 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (3R,4S)-3-acetyl-1-cyano-4-hydroxy-4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 15438726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).