About [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane
[(1E)-1-iodopenta-1,4-dienoxy]cyclohexane (PubChem CID 15438989) has the molecular formula C11H17IO
and a molecular weight of 292.16 g/mol. Its IUPAC name is [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane.
Molecular Properties
| Compound Name | [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane |
| PubChem CID | 15438989 |
| Molecular Formula | C11H17IO |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane |
| SMILES | C=CC/C=C(/I)OC1CCCCC1 |
| InChI | InChI=1S/C11H17IO/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h2,9-10H,1,3-8H2/b11-9- |
| InChIKey | SBDQZHDVTVUYQU-LUAWRHEFSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane?
The IUPAC name of [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane (CID 15438989) is [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane.
What is the SMILES notation for [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane?
The canonical SMILES for [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane is C=CC/C=C(/I)OC1CCCCC1.
What is the InChIKey of [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane?
The InChIKey is SBDQZHDVTVUYQU-LUAWRHEFSA-N. The full InChI is InChI=1S/C11H17IO/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h2,9-10H,1,3-8H2/b11-9-.
What are the key properties of [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane?
[(1E)-1-iodopenta-1,4-dienoxy]cyclohexane has a molecular weight of 292.16 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-1-iodopenta-1,4-dienoxy]cyclohexane is sourced from PubChem (CID 15438989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).