C11H19Cl3N6 — CID 154391237
4-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1H-1,3,5-triazine-2,4-diamine (PubChem CID 154391237) has the molecular formula C11H19Cl3N6 and a molecular weight of 341.67 g/mol. Its IUPAC name is 4-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 154391237 |
| Molecular Formula | C11H19Cl3N6 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1=NC(N)(CCCN2CCCC2)N=C(C(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C11H19Cl3N6/c12-11(13,14)8-17-9(15)19-10(16,18-8)4-3-7-20-5-1-2-6-20/h1-7,16H2,(H3,15,17,18,19) |
| InChIKey | YURHNHKKVZGAEO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|