C22H28O2 — CID 154391446
2-[(8R,9S,10R,13R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]prop-2-enal (PubChem CID 154391446) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]prop-2-enal.
| Compound Name | 2-[(8R,9S,10R,13R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]prop-2-enal |
|---|---|
| PubChem CID | 154391446 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-[(8R,9S,10R,13R,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@H]1CC=C2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H28O2/c1-14(13-23)18-6-7-19-17-5-4-15-12-16(24)8-10-21(15,2)20(17)9-11-22(18,19)3/h7,12-13,17-18,20H,1,4-6,8-11H2,2-3H3/t17-,18+,20-,21-,22+/m0/s1 |
| InChIKey | NDYBPTROQANRTI-XRYRHKQGSA-N |
| XLogP | 4.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|