About 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol
4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol (PubChem CID 154392110) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol |
| PubChem CID | 154392110 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2nc(C)c(C)[nH]2)cc(OC)c1O |
| InChI | InChI=1S/C13H16N2O3/c1-7-8(2)15-13(14-7)9-5-10(17-3)12(16)11(6-9)18-4/h5-6,16H,1-4H3,(H,14,15) |
| InChIKey | SVNNUCIFQDTAQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The IUPAC name of 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol (CID 154392110) is 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol is COc1cc(-c2nc(C)c(C)[nH]2)cc(OC)c1O.
What is the InChIKey of 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The InChIKey is SVNNUCIFQDTAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3/c1-7-8(2)15-13(14-7)9-5-10(17-3)12(16)11(6-9)18-4/h5-6,16H,1-4H3,(H,14,15).
What are the key properties of 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol has a molecular weight of 248.28 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol is sourced from PubChem (CID 154392110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).