C18H17N3O3 — CID 15439340
ethyl N-(3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridin-10-yl)carbamate (PubChem CID 15439340) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl N-(3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridin-10-yl)carbamate.
| Compound Name | ethyl N-(3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridin-10-yl)carbamate |
|---|---|
| PubChem CID | 15439340 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl N-(3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridin-10-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc2cc3ccc4c(c3nc2c1)COCN4 |
| InChI | InChI=1S/C18H17N3O3/c1-2-24-18(22)20-13-5-3-11-7-12-4-6-15-14(9-23-10-19-15)17(12)21-16(11)8-13/h3-8,19H,2,9-10H2,1H3,(H,20,22) |
| InChIKey | CICJQDIFTMGHTR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|